1-tert-butyl-4-[4-(trifluoromethyl)phenyl]-3,5,8-trioxabicyclo[2.2.2]octane structure
|
Common Name | 1-tert-butyl-4-[4-(trifluoromethyl)phenyl]-3,5,8-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 97720-11-1 | Molecular Weight | 316.31500 | |
| Density | 1.267g/cm3 | Boiling Point | 328.2ºC at 760 mmHg | |
| Molecular Formula | C16H19F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.3ºC | |
| Name | 1-tert-butyl-4-[4-(trifluoromethyl)phenyl]-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 328.2ºC at 760 mmHg |
| Molecular Formula | C16H19F3O3 |
| Molecular Weight | 316.31500 |
| Flash Point | 160.3ºC |
| Exact Mass | 316.12900 |
| PSA | 27.69000 |
| LogP | 3.92520 |
| Index of Refraction | 1.499 |
| InChIKey | RPONRNQRWIFHJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C12COC(c3ccc(C(F)(F)F)cc3)(OC1)OC2 |
| 2,6,7-Trioxabicyclo(2.2.2)octane,4-(1,1-dimethylethyl)-1-(4-(trifluoromethyl)phenyl) |
| Orthobenzoic acid,p-(trifluoromethyl)-,cyclic ester with 2-tert-butyl-2-(hydroxymethyl)-1,3-propanediol |