4-(1-tert-butyl-3,5,8-trioxabicyclo[2.2.2]octan-4-yl)benzonitrile structure
|
Common Name | 4-(1-tert-butyl-3,5,8-trioxabicyclo[2.2.2]octan-4-yl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 97720-14-4 | Molecular Weight | 273.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1-tert-butyl-3,5,8-trioxabicyclo[2.2.2]octan-4-yl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H19NO3 |
|---|---|
| Molecular Weight | 273.32700 |
| Exact Mass | 273.13600 |
| PSA | 51.48000 |
| LogP | 2.77808 |
| InChIKey | SRTDSGMDDPOYGJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C12COC(c3ccc(C#N)cc3)(OC1)OC2 |
| p-Cyanoorthobenzoic acid cyclic ester with 2-tert-butyl-2-(hydroxymethyl)-1,3-propanediol |
| 1-(4-Cyanophenyl)-4-tert-butylbicycloorthocarboxylate |
| Benzonitrile,4-(4-(1,1-dimethylethyl)-2,6,7-trioxabicyclo(2.2.2)oct-1-yl) |
| Orthobenzoic acid,p-cyano-,cyclic ester with 2-tert-butyl-2-(hydroxymethyl)-1,3-propanediol |