4-(4-methylphenyl)-1-propan-2-yl-3,5,8-trioxabicyclo[2.2.2]octane structure
|
Common Name | 4-(4-methylphenyl)-1-propan-2-yl-3,5,8-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 97720-20-2 | Molecular Weight | 248.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methylphenyl)-1-propan-2-yl-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20O3 |
|---|---|
| Molecular Weight | 248.31700 |
| Exact Mass | 248.14100 |
| PSA | 27.69000 |
| LogP | 2.82470 |
| InChIKey | WSQOGCKFZSGVMC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C23OCC(C(C)C)(CO2)CO3)cc1 |
| 1-(4-Methylphenyl)-4-isopropylbicycloorthocarboxylate |
| 1-(4-methylphenyl)-4-(propan-2-yl)-2,6,7-trioxabicyclo[2.2.2]octane |
| Orthobenzoic acid,p-methyl-,cyclic ester with 2-(hydroxymethyl)-2-isopropyl-1,3-propanediol |
| p-Methylorthobenzoic acid cyclic ester with 2-(hydroxymethyl)-2-isopropyl-1,3-propanediol |
| 2,6,7-Trioxabicyclo(2.2.2)octane,4-(1-methylethyl)-1-(4-methylphenyl) |