4-(2,3,4,5,6-pentafluorophenyl)-1-propan-2-yl-3,5,8-trioxabicyclo[2.2.2]octane structure
|
Common Name | 4-(2,3,4,5,6-pentafluorophenyl)-1-propan-2-yl-3,5,8-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 97720-26-8 | Molecular Weight | 324.24300 | |
| Density | 1.454g/cm3 | Boiling Point | 297.7ºC at 760 mmHg | |
| Molecular Formula | C14H13F5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.5ºC | |
| Name | 4-(2,3,4,5,6-pentafluorophenyl)-1-propan-2-yl-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 297.7ºC at 760 mmHg |
| Molecular Formula | C14H13F5O3 |
| Molecular Weight | 324.24300 |
| Flash Point | 141.5ºC |
| Exact Mass | 324.07800 |
| PSA | 27.69000 |
| LogP | 3.21180 |
| Index of Refraction | 1.485 |
| InChIKey | WKHKKXYZSKBXBN-UHFFFAOYSA-N |
| SMILES | CC(C)C12COC(c3c(F)c(F)c(F)c(F)c3F)(OC1)OC2 |
| Orthobenzoic acid,pentafluoro-,cyclic ester with 2-(hydroxymethyl)-2-isopropyl-1,3-propanediol |
| 2,6,7-Trioxabicyclo(2.2.2)octane,4-(1-methylethyl)-1-(pentafluorophenyl) |
| 1-(Pentafluorophenyl)-4-isopropylbicycloorthocarboxylate |