Z-GGL-AMC structure
|
Common Name | Z-GGL-AMC | ||
|---|---|---|---|---|
| CAS Number | 97792-39-7 | Molecular Weight | 536.58 | |
| Density | 1.281g/cm3 | Boiling Point | 877.6ºC at 760 mmHg | |
| Molecular Formula | C28H32N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 484.6ºC | |
Use of Z-GGL-AMCZ-Gly-Gly-Leu-AMC is the substrate of ClpP1 and ClpP2, to detect the enzymatic activity in the presence of the activating peptide Z-Leu-Leu[1]. |
| Name | z-gly-gly-leu-amc |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Gly-Gly-Leu-AMC is the substrate of ClpP1 and ClpP2, to detect the enzymatic activity in the presence of the activating peptide Z-Leu-Leu[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 877.6ºC at 760 mmHg |
| Molecular Formula | C28H32N4O7 |
| Molecular Weight | 536.58 |
| Flash Point | 484.6ºC |
| Exact Mass | 536.22700 |
| PSA | 155.84000 |
| LogP | 3.85910 |
| Index of Refraction | 1.593 |
| InChIKey | JEGGCCQOBMCUKZ-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)CNC(=O)CNC(=O)OCc1ccccc1)C(=O)Nc1ccc2c(C)cc(=O)oc2c1 |
|
~82%
Z-GGL-AMC CAS#:97792-39-7 |
| Literature: Kanaoka; Takahashi; Nakayama; Tanizawa Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 4 p. 1721 - 1724 |
| z-ggl-amc |
| proteasome substrate v,fluorogenic |