L-Alanine, 3,3'-[methylenebis(seleno)]bis structure
|
Common Name | L-Alanine, 3,3'-[methylenebis(seleno)]bis | ||
|---|---|---|---|---|
| CAS Number | 97801-57-5 | Molecular Weight | 348.11700 | |
| Density | N/A | Boiling Point | 529.6±50.0 °C (760 mmHg) | |
| Molecular Formula | C7H14N2O4Se2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | L-Alanine, 3,3'-[methylenebis(seleno)]bis |
|---|
| Boiling Point | 529.6±50.0 °C (760 mmHg) |
|---|---|
| Molecular Formula | C7H14N2O4Se2 |
| Molecular Weight | 348.11700 |
| Exact Mass | 349.92800 |
| PSA | 126.64000 |
| InChIKey | MDOLZXUUFCYHFB-WHFBIAKZSA-N |
| SMILES | NC(C[Se]C[Se]CC(N)C(=O)O)C(=O)O |
| HS Code | 2922499990 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |