2-(4-methoxyphenyl)-5H-1,5-benzothiazepine-3,4-dione structure
|
Common Name | 2-(4-methoxyphenyl)-5H-1,5-benzothiazepine-3,4-dione | ||
|---|---|---|---|---|
| CAS Number | 97801-79-1 | Molecular Weight | 299.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methoxyphenyl)-5H-1,5-benzothiazepine-3,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO3S |
|---|---|
| Molecular Weight | 299.34400 |
| Exact Mass | 299.06200 |
| PSA | 80.70000 |
| LogP | 3.18780 |
| InChIKey | LGFTULJJDDFVFE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2Sc3ccccc3NC(=O)C2=O)cc1 |
|
~89%
2-(4-methoxyphe... CAS#:97801-79-1 |
| Literature: ZAMBON GROUP S.p.A. Patent: EP1025080 B1, 2003 ; |
|
~88%
2-(4-methoxyphe... CAS#:97801-79-1 |
| Literature: Yamada, Shin-Ichi; Mori, Yoshikazu; Morimatsu, Katsuji; Ishizu, Yoshinori; Ozaki, Yasuhiko; Yoshioka, Ryuzo; Nakatani, Tadashi; Seko, Hiroyasu Journal of Organic Chemistry, 1996 , vol. 61, # 24 p. 8586 - 8590 |
|
~%
2-(4-methoxyphe... CAS#:97801-79-1 |
| Literature: Yamada, Shin-Ichi; Mori, Yoshikazu; Morimatsu, Katsuji; Ishizu, Yoshinori; Ozaki, Yasuhiko; Yoshioka, Ryuzo; Nakatani, Tadashi; Seko, Hiroyasu Journal of Organic Chemistry, 1996 , vol. 61, # 24 p. 8586 - 8590 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(4-methoxyphenyl)-1,5-benzothiazepin-3,4(2H,5H)-dione |
| 1,5-Benzothiazepine-3,4(2H,5H)-dione,2-(4-methoxyphenyl) |
| 2-(4-methoxyphenyl)benzo[b][1,4]thiazepine-3,4(2H,5H)-dione |
| 2-(4-methoxyphenyl)-1,5-benzothiazepine-3,4(2H,5H)-dione |
| (2RS)-2-(4-methoxyphenyl)-1,5-benzothiazepine-3,4-(2H,5H)-dione |