dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane structure
|
Common Name | dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane | ||
|---|---|---|---|---|
| CAS Number | 97802-57-8 | Molecular Weight | 230.37600 | |
| Density | 0.994g/cm3 | Boiling Point | 256.035ºC at 760 mmHg | |
| Molecular Formula | C11H22O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.593ºC | |
| Name | dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.994g/cm3 |
|---|---|
| Boiling Point | 256.035ºC at 760 mmHg |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.37600 |
| Flash Point | 85.593ºC |
| Exact Mass | 230.13400 |
| PSA | 30.99000 |
| LogP | 2.30880 |
| Index of Refraction | 1.454 |
| InChIKey | SLQTWNAJXFHMHM-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(CCC1CCC2OC2C1)OC |
| HS Code | 2932999099 |
|---|
|
~84%
dimethoxy-methy... CAS#:97802-57-8 |
| Literature: Filipkowski, Michelle A.; Petty, Herbert E.; Westmeyer, Mark D.; Schilling Jr., Curtis L. Organic Process Research and Development, 2002 , vol. 6, # 1 p. 15 - 19 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-iso-propoxy-phenyl)-quinoline-4-carboxylic |
| 2-(4-epoxycyclohexyl)ethylmethyldimethoxysilane |