1-methyl-5-nitro-2-[(1-nitrocycloheptyl)methyl]imidazole structure
|
Common Name | 1-methyl-5-nitro-2-[(1-nitrocycloheptyl)methyl]imidazole | ||
|---|---|---|---|---|
| CAS Number | 97945-36-3 | Molecular Weight | 282.29600 | |
| Density | 1.41g/cm3 | Boiling Point | 488.5ºC at 760mmHg | |
| Molecular Formula | C12H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.2ºC | |
| Name | 1-methyl-5-nitro-2-[(1-nitrocycloheptyl)methyl]imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 488.5ºC at 760mmHg |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.29600 |
| Flash Point | 249.2ºC |
| Exact Mass | 282.13300 |
| PSA | 109.46000 |
| LogP | 3.28690 |
| Index of Refraction | 1.634 |
| InChIKey | TWBSNTOHQPLDLO-UHFFFAOYSA-N |
| SMILES | Cn1c([N+](=O)[O-])cnc1CC1([N+](=O)[O-])CCCCCC1 |
|
~74%
1-methyl-5-nitr... CAS#:97945-36-3 |
| Literature: Crozet, Michel P.; Surzur, Jean-Marie; Vanelle, Patrice; Ghiglione, Claude; Maldonado, Jose Tetrahedron Letters, 1985 , vol. 26, # 8 p. 1023 - 1026 |
|
~%
1-methyl-5-nitr... CAS#:97945-36-3 |
| Literature: Vanelle; Crozet; Maldonado; Barreau European Journal of Medicinal Chemistry, 1991 , vol. 26, # 2 p. 167 - 178 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-methyl 2-(1-nitrocycloheptylmethyl) 5-nitroimidazole |
| 1-Methyl-5-nitro-2-((1-nitrocycloheptyl)methyl)-1H-imidazole |