2-[(4-methoxypyridin-2-yl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole structure
|
Common Name | 2-[(4-methoxypyridin-2-yl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 97963-96-7 | Molecular Weight | 403.35100 | |
| Density | 1.56g/cm3 | Boiling Point | 578.1ºC at 760 mmHg | |
| Molecular Formula | C16H13F4N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.4ºC | |
| Name | 2-[(4-methoxypyridin-2-yl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 578.1ºC at 760 mmHg |
| Molecular Formula | C16H13F4N3O3S |
| Molecular Weight | 403.35100 |
| Flash Point | 303.4ºC |
| Exact Mass | 403.06100 |
| PSA | 96.31000 |
| LogP | 4.37670 |
| Index of Refraction | 1.615 |
| InChIKey | IWECCZBOLCDNSE-UHFFFAOYSA-N |
| SMILES | COc1ccnc(CS(=O)c2nc3ccc(OC(F)(F)C(F)F)cc3[nH]2)c1 |
|
Name: In vitro evaluation for the inhibition of H+/K+ ATPase at pH < 3 in the gastric gland...
Source: ChEMBL
Target: Potassium-transporting ATPase alpha chain 1
External Id: CHEMBL858329
|
|
Name: In vitro evaluation for its ability to inhibit the Na+/K+ ATPase at pH 7.4.
Source: ChEMBL
Target: Sodium/potassium-transporting ATPase subunit beta-2
External Id: CHEMBL858332
|
| 2-{[(4-methoxypyridin-2-yl)methyl]sulfinyl}-6-(1,1,2,2-tetrafluoroethoxy)-1h-benzimidazole |
| 2-[(4-methoxy-pyridin-2-yl)methylsulfinyl]-5-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
| 2-[(4-methoxy-2-pyridyl)methylsulfinyl]-5-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |