Acetamide,N-[4-(dihydroxyoxidostibino)phenyl]
![Acetamide,N-[4-(dihydroxyoxidostibino)phenyl] Structure](https://image.chemsrc.com/caspic/008/98-76-0.png)
Acetamide,N-[4-(dihydroxyoxidostibino)phenyl] structure
|
Common Name | Acetamide,N-[4-(dihydroxyoxidostibino)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 98-76-0 | Molecular Weight | 305.92900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10NO4Sb | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | p-Acetamidobenzenestibonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10NO4Sb |
|---|---|
| Molecular Weight | 305.92900 |
| Exact Mass | 304.96500 |
| PSA | 86.63000 |
| LogP | 1.04580 |
| InChIKey | VCRSJHLUNDQHNW-UHFFFAOYSA-L |
| SMILES | CC(=O)Nc1ccc([Sb](=O)(O)O)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (4-acetamidophenyl)stibonic acid |
| Acetamide,Sb-oxide |
| Benzenestibonic acid,p-acetamido |
| p-Acetamidobenzenestibonic acid |
| Acetanilide,4'-stibono |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of p-Acetamidobenzenestibonic acid? |
| A: Molecular formula of p-Acetamidobenzenestibonic acid is C8H10NO4Sb. |
| Q: What English synonyms does p-Acetamidobenzenestibonic acid have? |
| A: English synonyms of p-Acetamidobenzenestibonic acid: (4-acetamidophenyl)stibonic acid, Acetamide,Sb-oxide, Benzenestibonic acid,p-acetamido, p-Acetamidobenzenestibonic acid, Acetanilide,4'-stibono. |
| Q: What is the SMILES notation of p-Acetamidobenzenestibonic acid? |
| A: SMILES notation of p-Acetamidobenzenestibonic acid is CC(=O)Nc1ccc([Sb](=O)(O)O)cc1. |
| Q: What is the LogP of p-Acetamidobenzenestibonic acid? |
| A: LogP of p-Acetamidobenzenestibonic acid is 1.04580. |
| Q: What is the molecular weight of p-Acetamidobenzenestibonic acid? |
| A: Molecular weight of p-Acetamidobenzenestibonic acid is 305.92900. |
| Q: What is the CAS number of p-Acetamidobenzenestibonic acid? |
| A: CAS number of p-Acetamidobenzenestibonic acid is 98-76-0. |
| Q: What is the polar surface area (PSA) of p-Acetamidobenzenestibonic acid? |
| A: Polar surface area (PSA) of p-Acetamidobenzenestibonic acid is 86.63000. |
| Q: What is the InChIKey of p-Acetamidobenzenestibonic acid? |
| A: InChIKey of p-Acetamidobenzenestibonic acid is VCRSJHLUNDQHNW-UHFFFAOYSA-L. |
| Q: What is the English name of p-Acetamidobenzenestibonic acid? |
| A: The English name of p-Acetamidobenzenestibonic acid is p-Acetamidobenzenestibonic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |