3-[[amino(methyl)amino]methyl]-4-bromophenol,benzenesulfonic acid,oxalic acid structure
|
Common Name | 3-[[amino(methyl)amino]methyl]-4-bromophenol,benzenesulfonic acid,oxalic acid | ||
|---|---|---|---|---|
| CAS Number | 98000-18-1 | Molecular Weight | 479.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19BrN2O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[[amino(methyl)amino]methyl]-4-bromophenol,benzenesulfonic acid,oxalic acid |
|---|
| Molecular Formula | C16H19BrN2O8S |
|---|---|
| Molecular Weight | 479.30000 |
| Exact Mass | 478.00500 |
| PSA | 186.84000 |
| LogP | 3.33020 |
| InChIKey | YOCCUXVMEOJHLO-UHFFFAOYSA-N |
| SMILES | CN(N)Cc1cc(O)ccc1Br.O=C(O)C(=O)O.O=S(=O)(O)c1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |