3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione
3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione structure
|
Common Name | 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione | ||
|---|---|---|---|---|
| CAS Number | 98006-76-9 | Molecular Weight | 272.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3,8,8-Trimethyl-1-phenylnon-5-ene-1,7-dione (CAS number: 98006-76-9) is an organic compound with molecular formula C18H24O2 and molecular weight 272.38200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H24O2 |
|---|---|
| Molecular Weight | 272.38200 |
| Exact Mass | 272.17800 |
| PSA | 34.14000 |
| LogP | 4.45700 |
| InChIKey | BIHLETWKNQOCEM-UHFFFAOYSA-N |
| SMILES | CC(CC=CC(=O)C(C)(C)C)CC(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
3,8,8-trimethyl... CAS#:98006-76-9 |
| Literature: Stevens, Rodney W.; Mukaiyama, Teruaki Chemistry Letters, 1985 , p. 851 - 854 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Nonene-1,7-dione,3,8,8-trimethyl-1-phenyl-,(E) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione have? |
| A: English synonyms of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione: 5-Nonene-1,7-dione,3,8,8-trimethyl-1-phenyl-,(E). |
| Q: What is the SMILES notation of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione? |
| A: SMILES notation of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione is CC(CC=CC(=O)C(C)(C)C)CC(=O)c1ccccc1. |
| Q: What are the upstream materials of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione? |
| A: Related upstream materials(CAS) of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione: 55532-07-5;35660-91-4. |
| Q: What is the InChIKey of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione? |
| A: InChIKey of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione is BIHLETWKNQOCEM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione? |
| A: CAS number of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione is 98006-76-9. |
| Q: What is the English name of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione? |
| A: The English name of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione is 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione. |
| Q: What is the Chinese name of 98006-76-9? |
| A: Chinese name of 98006-76-9 is 98006-76-9. |
| Q: What is the molecular weight of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione? |
| A: Molecular weight of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione is 272.38200. |
| Q: What is the polar surface area (PSA) of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione? |
| A: Polar surface area (PSA) of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione is 34.14000. |
| Q: What is the molecular formula of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione? |
| A: Molecular formula of 3,8,8-trimethyl-1-phenylnon-5-ene-1,7-dione is C18H24O2. |