2-(2-Methoxy-benzoyl)-cyclohexane-1,3-dione structure
|
Common Name | 2-(2-Methoxy-benzoyl)-cyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 98012-33-0 | Molecular Weight | 246.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-Methoxy-benzoyl)-cyclohexane-1,3-dione |
|---|
| Molecular Formula | C14H14O4 |
|---|---|
| Molecular Weight | 246.26 |
| InChIKey | ADJLOHOSFKJYEC-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)C1C(=O)CCCC1=O |
|
Name: Inhibition of 4-hydroxyphenylpyruvate dioxygenase of purified pig liver by enol-borat...
Source: ChEMBL
Target: 4-hydroxyphenylpyruvate dioxygenase
External Id: CHEMBL615567
|