3,4,6-trimethyl-5-phenyl-1H-pyridin-2-one structure
|
Common Name | 3,4,6-trimethyl-5-phenyl-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 98042-74-1 | Molecular Weight | 213.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4,6-trimethyl-5-phenyl-1H-pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15NO |
|---|---|
| Molecular Weight | 213.27500 |
| Exact Mass | 213.11500 |
| PSA | 33.12000 |
| LogP | 3.37940 |
| InChIKey | FCLGRRACFRHJRT-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)c(C)c(C)c1-c1ccccc1 |
| HS Code | 2933399090 |
|---|
|
~%
3,4,6-trimethyl... CAS#:98042-74-1 |
| Literature: Kuzuya; Noguchi; Kamiya; Okuda Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 6 p. 2313 - 2322 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-HYDROXY-3,4,6-TRIMETHYL-5-PHENYLPYRIDINE |
| 3,4,6-trimethyl-5-phenyl-2-pyridone |