CID 119097920
Modify Date: 2025-09-09 18:34:18
CID 119097920 structure
|
Common Name | CID 119097920 | ||
|---|---|---|---|---|
| CAS Number | 98138-95-5 | Molecular Weight | 318.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5Cl5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 119097920 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5Cl5O4 |
|---|---|
| Molecular Weight | 318.4 |
| InChIKey | PRMOXGALLQNTEG-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cl)C(Cl)C(Cl)C(Cl)(Cl)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 98138-95-5? |
| A: Chinese name of 98138-95-5 is 98138-95-5. |
| Q: What is the SMILES notation of CID 119097920? |
| A: SMILES notation of CID 119097920 is O=C(O)C(Cl)C(Cl)C(Cl)C(Cl)(Cl)C(=O)O. |
| Q: What is the InChIKey of CID 119097920? |
| A: InChIKey of CID 119097920 is PRMOXGALLQNTEG-UHFFFAOYSA-N. |
| Q: What is the CAS number of CID 119097920? |
| A: CAS number of CID 119097920 is 98138-95-5. |
| Q: What is the molecular formula of CID 119097920? |
| A: Molecular formula of CID 119097920 is C6H5Cl5O4. |
| Q: What is the molecular weight of CID 119097920? |
| A: Molecular weight of CID 119097920 is 318.4. |
| Q: What is the English name of CID 119097920? |
| A: The English name of CID 119097920 is CID 119097920. |