4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile
Modify Date: 2025-09-04 14:42:21
![4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile Structure](https://www.chemsrc.com/extcaspic/330/98251-32-2.png)
4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile structure
|
Common Name | 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 98251-32-2 | Molecular Weight | 270.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H10N2O |
|---|---|
| Molecular Weight | 270.3 |
| InChIKey | WBXQGFUSBNHZLV-UHFFFAOYSA-N |
| SMILES | N#Cc1c[nH]c2c(ccc3cc4ccccc4cc32)c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile? |
| A: InChIKey of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile is WBXQGFUSBNHZLV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile? |
| A: Molecular weight of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile is 270.3. |
| Q: What is the English name of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile? |
| A: The English name of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile is 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile. |
| Q: What is the molecular formula of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile? |
| A: Molecular formula of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile is C18H10N2O. |
| Q: What is the Chinese name of 98251-32-2? |
| A: Chinese name of 98251-32-2 is 98251-32-2. |
| Q: What is the SMILES notation of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile? |
| A: SMILES notation of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile is N#Cc1c[nH]c2c(ccc3cc4ccccc4cc32)c1=O. |
| Q: What is the CAS number of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile? |
| A: CAS number of 4-Hydroxynaphtho[2,3-h]quinoline-3-carbonitrile is 98251-32-2. |