4-chlorosulfonyl-2-hydroxybenzoic acid structure
|
Common Name | 4-chlorosulfonyl-2-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 98273-15-5 | Molecular Weight | 236.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5ClO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chlorosulfonyl-2-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5ClO5S |
|---|---|
| Molecular Weight | 236.63000 |
| Exact Mass | 235.95500 |
| PSA | 100.05000 |
| LogP | 2.09870 |
| InChIKey | JVXZKJYMVWASCR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Cl)cc1O |
| HS Code | 2918290000 |
|---|
|
~%
4-chlorosulfony... CAS#:98273-15-5 |
| Literature: Farbenfabr.Bayer Patent: DE959731 , 1954 ; Full Text Show Details Schenley Ind. Patent: US2852557 , 1955 ; |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-(CHLOROSULFONYL)-2-HYDROXYBENZOIC ACID |
| Benzoic acid,4-(chlorosulfonyl)-2-hydroxy |
| 3-hydroxy-4-carboxybenzene sulfonyl chloride |
| 4-chlorosulphonyl-2-hydroxybenzoic acid |
| 4-Chlorsulfonyl-2-hydroxy-benzoesaeure |