2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide
2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide structure
|
Common Name | 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide | ||
|---|---|---|---|---|
| CAS Number | 98288-52-9 | Molecular Weight | 279.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11BrN2O |
|---|---|
| Molecular Weight | 279.13300 |
| Exact Mass | 278.00500 |
| PSA | 33.84000 |
| InChIKey | AITAUFYLQSNHNT-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccccc1)c1ccccn1.[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-pyridin-1-ium... CAS#:98288-52-9 |
| Literature: Sterling Winthrop Inc. Patent: US5559214 A1, 1996 ; |
|
~%
2-pyridin-1-ium... CAS#:98288-52-9 |
| Literature: Mamula, Olimpia; Von Zelewsky, Alex; Bark, Thomas; Stoeckli-Evans, Helen; Neels, Antonia; Bernardinelli, Gerald Chemistry - A European Journal, 2000 , vol. 6, # 19 p. 3575 - 3585 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:123760-40-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(2-acetylpyridyl)pyridinium bromide |
| 1-(2-oxo-2-pyridin-2-yl-ethyl)-pyridinium,bromide |
| 1-[2-(2-Pyridinyl)-2-oxoethyl]pyridinium bromide |
| Pyridinium,1-[2-oxo-2-(2-pyridinyl)ethyl]-,bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide? |
| A: Molecular weight of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide is 279.13300. |
| Q: What is the English name of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide? |
| A: The English name of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide is 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide. |
| Q: What are the downstream products of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide? |
| A: Related downstream products(CAS) of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide: 123760-40-7. |
| Q: What are the upstream materials of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide? |
| A: Related upstream materials(CAS) of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide: 1122-62-9;110-86-1. |
| Q: What English synonyms does 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide have? |
| A: English synonyms of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide: 1-(2-acetylpyridyl)pyridinium bromide, 1-(2-oxo-2-pyridin-2-yl-ethyl)-pyridinium,bromide, 1-[2-(2-Pyridinyl)-2-oxoethyl]pyridinium bromide, Pyridinium,1-[2-oxo-2-(2-pyridinyl)ethyl]-,bromide. |
| Q: What is the Chinese name of 98288-52-9? |
| A: Chinese name of 98288-52-9 is 98288-52-9. |
| Q: What is the SMILES notation of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide? |
| A: SMILES notation of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide is O=C(C[n+]1ccccc1)c1ccccn1.[Br-]. |
| Q: What is the polar surface area (PSA) of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide? |
| A: Polar surface area (PSA) of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide is 33.84000. |
| Q: What is the CAS number of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide? |
| A: CAS number of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide is 98288-52-9. |
| Q: What is the molecular formula of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide? |
| A: Molecular formula of 2-pyridin-1-ium-1-yl-1-pyridin-2-ylethanone,bromide is C12H11BrN2O. |