(4-oxo-1-phenylcyclohexa-2,5-dien-1-yl) acetate structure
|
Common Name | (4-oxo-1-phenylcyclohexa-2,5-dien-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 98355-34-1 | Molecular Weight | 228.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-oxo-1-phenylcyclohexa-2,5-dien-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.24300 |
| Exact Mass | 228.07900 |
| PSA | 43.37000 |
| LogP | 2.14010 |
| InChIKey | SFVKDGDACULKBT-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1(c2ccccc2)C=CC(=O)C=C1 |
|
~%
(4-oxo-1-phenyl... CAS#:98355-34-1 |
| Literature: Wessely et al. Monatshefte fuer Chemie, 1952 , vol. 83, p. 1253,1256 |
|
~24%
(4-oxo-1-phenyl... CAS#:98355-34-1 |
| Literature: Benedini, Francesca; Galliani, Guido; Nali, Micaela; Rindone, Bruno; Tollari, Stefano Gazzetta Chimica Italiana, 1985 , vol. 115, # 6 p. 343 - 346 |
|
~24%
(4-oxo-1-phenyl... CAS#:98355-34-1 |
| Literature: Benedini, Francesca; Galliani, Guido; Nali, Micaela; Rindone, Bruno; Tollari, Stefano Gazzetta Chimica Italiana, 1985 , vol. 115, # 6 p. 343 - 346 |
|
~%
(4-oxo-1-phenyl... CAS#:98355-34-1 |
| Literature: Abe Bulletin of the Chemical Society of Japan, 1943 , vol. 18, p. 93,96 |
| Precursor 5 | |
|---|---|
| DownStream 5 | |
| 4-acetoxy-4-phenyl-2,5-cyclohexadienone |
| 4-acetoxy-4-phenyl-cyclohexa-2,5-dienone |
| 4-Acetoxy-4-phenyl-cyclohexa-2,5-dienon |
| 4-acetoxy-4-phenyl-2,5-cyclohexanedienone |
| 2,5-Cyclohexadien-1-one,4-(acetyloxy)-4-phenyl |
| Acetic acid 4-oxo-1-phenyl-cyclohexa-2,5-dienyl ester |