N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide
![N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide Structure](https://image.chemsrc.com/caspic/240/98366-07-5.png)
N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide structure
|
Common Name | N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 98366-07-5 | Molecular Weight | 267.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17NO2 |
|---|---|
| Molecular Weight | 267.32200 |
| Exact Mass | 267.12600 |
| PSA | 49.66000 |
| LogP | 3.89540 |
| InChIKey | HAYAFYJIFICBJT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C(=O)c1ccccc1)c1ccc(C)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
N-[1-(4-methylp... CAS#:98366-07-5 |
| Literature: Boroujeni, Kaveh Parvanak; Taheri, Somayeh; Seyfipour, Giti Synthesis and Reactivity in Inorganic, Metal-Organic and Nano-Metal Chemistry, 2014 , vol. 44, # 1 p. 84 - 88 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(4-Tolyl)-2-phenyl-1-acetamino-ethan-2-on |
| Acetamide,N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide? |
| A: Related upstream materials(CAS) of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide: 104-87-0;98-86-2;75-05-8. |
| Q: What English synonyms does N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide have? |
| A: English synonyms of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide: 1-(4-Tolyl)-2-phenyl-1-acetamino-ethan-2-on, Acetamide,N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]. |
| Q: What is the LogP of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide? |
| A: LogP of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide is 3.89540. |
| Q: What is the molecular weight of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide? |
| A: Molecular weight of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide is 267.32200. |
| Q: What is the InChIKey of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide? |
| A: InChIKey of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide is HAYAFYJIFICBJT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 98366-07-5? |
| A: Chinese name of 98366-07-5 is 98366-07-5. |
| Q: What is the SMILES notation of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide? |
| A: SMILES notation of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide is CC(=O)NC(C(=O)c1ccccc1)c1ccc(C)cc1. |
| Q: What is the polar surface area (PSA) of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide? |
| A: Polar surface area (PSA) of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide is 49.66000. |
| Q: What is the molecular formula of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide? |
| A: Molecular formula of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide is C17H17NO2. |
| Q: What is the CAS number of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide? |
| A: CAS number of N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide is 98366-07-5. |