N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide structure
|
Common Name | N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 98366-07-5 | Molecular Weight | 267.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17NO2 |
|---|---|
| Molecular Weight | 267.32200 |
| Exact Mass | 267.12600 |
| PSA | 49.66000 |
| LogP | 3.89540 |
| InChIKey | HAYAFYJIFICBJT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C(=O)c1ccccc1)c1ccc(C)cc1 |
|
~95%
N-[1-(4-methylp... CAS#:98366-07-5 |
| Literature: Boroujeni, Kaveh Parvanak; Taheri, Somayeh; Seyfipour, Giti Synthesis and Reactivity in Inorganic, Metal-Organic and Nano-Metal Chemistry, 2014 , vol. 44, # 1 p. 84 - 88 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(4-Tolyl)-2-phenyl-1-acetamino-ethan-2-on |
| Acetamide,N-[1-(4-methylphenyl)-2-oxo-2-phenylethyl] |