3-(benzenesulfinyl)-1H-indole
3-(benzenesulfinyl)-1H-indole structure
|
Common Name | 3-(benzenesulfinyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 98508-67-9 | Molecular Weight | 241.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(benzenesulfinyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11NOS |
|---|---|
| Molecular Weight | 241.30800 |
| Exact Mass | 241.05600 |
| PSA | 52.07000 |
| LogP | 4.20030 |
| InChIKey | QSOCAQZXDDZKER-UHFFFAOYSA-N |
| SMILES | O=S(c1ccccc1)c1c[nH]c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
3-(benzenesulfi... CAS#:98508-67-9 |
| Literature: Garcia, Josefina; Ortiz, Claudio; Greenhouse, Robert Journal of Organic Chemistry, 1988 , vol. 53, # 11 p. 2634 - 2637 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:108698-57-3
CAS#:51072-85-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole,3-(phenylsulfinyl) |
| 3-(phenylsulfinyl)-1H-indole |
| 3-(phenylsulfinyl)indole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(benzenesulfinyl)-1H-indole? |
| A: CAS number of 3-(benzenesulfinyl)-1H-indole is 98508-67-9. |
| Q: What is the InChIKey of 3-(benzenesulfinyl)-1H-indole? |
| A: InChIKey of 3-(benzenesulfinyl)-1H-indole is QSOCAQZXDDZKER-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(benzenesulfinyl)-1H-indole? |
| A: The English name of 3-(benzenesulfinyl)-1H-indole is 3-(benzenesulfinyl)-1H-indole. |
| Q: What English synonyms does 3-(benzenesulfinyl)-1H-indole have? |
| A: English synonyms of 3-(benzenesulfinyl)-1H-indole: 1H-Indole,3-(phenylsulfinyl), 3-(phenylsulfinyl)-1H-indole, 3-(phenylsulfinyl)indole. |
| Q: What is the molecular weight of 3-(benzenesulfinyl)-1H-indole? |
| A: Molecular weight of 3-(benzenesulfinyl)-1H-indole is 241.30800. |
| Q: What is the polar surface area (PSA) of 3-(benzenesulfinyl)-1H-indole? |
| A: Polar surface area (PSA) of 3-(benzenesulfinyl)-1H-indole is 52.07000. |
| Q: What are the downstream products of 3-(benzenesulfinyl)-1H-indole? |
| A: Related downstream products(CAS) of 3-(benzenesulfinyl)-1H-indole: 108698-57-3;51072-85-6. |
| Q: What are the upstream materials of 3-(benzenesulfinyl)-1H-indole? |
| A: Related upstream materials(CAS) of 3-(benzenesulfinyl)-1H-indole: 54491-43-9. |
| Q: What is the Chinese name of 98508-67-9? |
| A: Chinese name of 98508-67-9 is 98508-67-9. |
| Q: What is the SMILES notation of 3-(benzenesulfinyl)-1H-indole? |
| A: SMILES notation of 3-(benzenesulfinyl)-1H-indole is O=S(c1ccccc1)c1c[nH]c2ccccc12. |