methyl 16,17-didehydro-19α-methyloxayohimban-16-carboxylate, compound with 5-oxo-L-proline (1:1) structure
|
Common Name | methyl 16,17-didehydro-19α-methyloxayohimban-16-carboxylate, compound with 5-oxo-L-proline (1:1) | ||
|---|---|---|---|---|
| CAS Number | 98510-81-7 | Molecular Weight | 481.54100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H31N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | einecs 308-790-1 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H31N3O6 |
|---|---|
| Molecular Weight | 481.54100 |
| Exact Mass | 481.22100 |
| PSA | 124.45000 |
| LogP | 2.74220 |
| InChIKey | AIKWEAJZOJUNMB-OFDNHZRLSA-N |
| SMILES | COC(=O)C1=COC(C)C2CN3CCc4c([nH]c5ccccc45)C3CC12.O=C1CCC(C(=O)O)N1 |
| Methyl 16,17-didehydro-19alpha-methyloxayohimban-16-carboxylate,compound with 5-oxo-L-proline (1:1) |