Ethyl 5-bromo-1-phenyl-1H-pyrazole-4-carboxylate structure
|
Common Name | Ethyl 5-bromo-1-phenyl-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 98534-71-5 | Molecular Weight | 295.132 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 375.1±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H11BrN2O2 | Melting Point | 87-88 °C | |
| MSDS | N/A | Flash Point | 180.6±22.3 °C | |
| Name | ethyl 5-bromo-1-phenylpyrazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.1±22.0 °C at 760 mmHg |
| Melting Point | 87-88 °C |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.132 |
| Flash Point | 180.6±22.3 °C |
| Exact Mass | 294.000397 |
| PSA | 44.12000 |
| LogP | 3.69 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | JLHHULMEYIHSNI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1Br |
| HS Code | 2933199090 |
|---|
|
~38%
Ethyl 5-bromo-1... CAS#:98534-71-5 |
| Literature: Eli Lilly and Company Patent: US4620865 A1, 1986 ; |
|
~59%
Ethyl 5-bromo-1... CAS#:98534-71-5 |
| Literature: Beck, James R.; Gajewski, Robert P.; Lynch, Michael P.; Wright, Fred L. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 267 - 270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole-4-carboxylic acid, 5-bromo-1-phenyl-, ethyl ester |
| RD-0245 |
| 5-BROMO-1-PHENYL-1H-PYRAZOLE-4-CARBOXYLIC ACID ETHYL ESTER |
| QC-4464 |
| Ethyl 5-bromo-1-phenyl-1H-pyrazole-4-carboxylate |