2-(2-Bromo-4-chlorophenoxy)propanoic acid
Modify Date: 2025-09-18 11:37:55
2-(2-Bromo-4-chlorophenoxy)propanoic acid structure
|
Common Name | 2-(2-Bromo-4-chlorophenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 98590-32-0 | Molecular Weight | 279.51500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-Bromo-4-chlorophenoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8BrClO3 |
|---|---|
| Molecular Weight | 279.51500 |
| Exact Mass | 277.93500 |
| PSA | 46.53000 |
| LogP | 2.95440 |
| InChIKey | PDZQJUYZUQKLAQ-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Cl)cc1Br)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| f3191-0011 |