trandolapril benzyl ester
trandolapril benzyl ester structure
|
Common Name | trandolapril benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 98677-37-3 | Molecular Weight | 520.66000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H40N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trandolapril benzyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H40N2O5 |
|---|---|
| Molecular Weight | 520.66000 |
| Exact Mass | 520.29400 |
| PSA | 84.94000 |
| LogP | 4.76090 |
| InChIKey | UROPPNGEPNCIGO-CPFCZLQXSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1C(C(=O)OCc2ccccc2)CC2CCCCC21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:87679-37-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzyl N-[1S-carboethoxy-3-phenylpropyl]-S-alanyl-2S,3aR,7aS-octahydroindole-2-carboxylate |
| benzyl(2S,3aR,7aS)-1-[(2S)-2-[[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]amino]-1-oxopropyl]octahydro-1H-indole-2-carboxylate |
| benzyl ester of tandolapril |
| Trandolapril Benzyl Ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of trandolapril benzyl ester? |
| A: Molecular weight of trandolapril benzyl ester is 520.66000. |
| Q: What is the molecular formula of trandolapril benzyl ester? |
| A: Molecular formula of trandolapril benzyl ester is C31H40N2O5. |
| Q: What is the polar surface area (PSA) of trandolapril benzyl ester? |
| A: Polar surface area (PSA) of trandolapril benzyl ester is 84.94000. |
| Q: What is the English name of trandolapril benzyl ester? |
| A: The English name of trandolapril benzyl ester is trandolapril benzyl ester. |
| Q: What is the SMILES notation of trandolapril benzyl ester? |
| A: SMILES notation of trandolapril benzyl ester is CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1C(C(=O)OCc2ccccc2)CC2CCCCC21. |
| Q: What is the InChIKey of trandolapril benzyl ester? |
| A: InChIKey of trandolapril benzyl ester is UROPPNGEPNCIGO-CPFCZLQXSA-N. |
| Q: What is the LogP of trandolapril benzyl ester? |
| A: LogP of trandolapril benzyl ester is 4.76090. |
| Q: What is the CAS number of trandolapril benzyl ester? |
| A: CAS number of trandolapril benzyl ester is 98677-37-3. |
| Q: What are the downstream products of trandolapril benzyl ester? |
| A: Related downstream products(CAS) of trandolapril benzyl ester: 87679-37-6. |
| Q: What English synonyms does trandolapril benzyl ester have? |
| A: English synonyms of trandolapril benzyl ester: benzyl N-[1S-carboethoxy-3-phenylpropyl]-S-alanyl-2S,3aR,7aS-octahydroindole-2-carboxylate, benzyl(2S,3aR,7aS)-1-[(2S)-2-[[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]amino]-1-oxopropyl]octahydro-1H-indole-2-carboxylate, benzyl ester of tandolapril, Trandolapril Benzyl Ester. |