Z-Glu-Phe-OH
Modify Date: 2026-06-30 04:29:50
Z-Glu-Phe-OH structure
|
Common Name | Z-Glu-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 987-84-8 | Molecular Weight | 428.43500 | |
| Density | 1.325 g/cm3 | Boiling Point | 760.4ºC at 760 mmHg | |
| Molecular Formula | C22H24N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 413.7ºC | |
| Name | 5-[(1-carboxy-2-phenylethyl)amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325 g/cm3 |
|---|---|
| Boiling Point | 760.4ºC at 760 mmHg |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.43500 |
| Flash Point | 413.7ºC |
| Exact Mass | 428.15800 |
| PSA | 142.03000 |
| LogP | 2.74010 |
| Index of Refraction | 1.592 |
| InChIKey | ZORDBMVWKMEZAC-ROUUACIJSA-N |
| SMILES | O=C(O)CCC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:6398-06-7|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| EINECS 213-581-2 |
| Cbz-L-Glu-L-Phe-OH |
| Z-Glu-Phe-OH |