6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid
6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid structure
|
Common Name | 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 98772-02-2 | Molecular Weight | 289.28700 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.28700 |
| Exact Mass | 289.10600 |
| PSA | 104.57000 |
| LogP | 2.48580 |
| InChIKey | SYPFQPZYPNNRJU-UHFFFAOYSA-N |
| SMILES | CCCOc1ccccc1Nc1ncc(C(=O)O)c(=O)[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~61%
6-oxo-2-(2-prop... CAS#:98772-02-2 |
| Literature: Ozeki; Ichikawa; Takehara; Tanimura; Sato; Yaginuma Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 7 p. 1780 - 1787 |
|
~%
6-oxo-2-(2-prop... CAS#:98772-02-2 |
| Literature: Ozeki; Ichikawa; Takehara; Tanimura; Sato; Yaginuma Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 7 p. 1780 - 1787 |
|
~%
6-oxo-2-(2-prop... CAS#:98772-02-2 |
| Literature: Ozeki; Ichikawa; Takehara; Tanimura; Sato; Yaginuma Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 7 p. 1780 - 1787 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Pyrimidinecarboxylic acid,1,4-dihydro-4-oxo-2-((2-propoxy)phenyl)amino) |
| 1,6-Dihydro-2-(2-propoxyanilino)-6-oxo-5-pyrimidinecarboxylic acid |
| 1,4-Dihydro-4-oxo-2-((2-propoxyphenyl)amino)-5-pyrimidinecarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 98772-02-2? |
| A: Chinese name of 98772-02-2 is 98772-02-2. |
| Q: What is the English name of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid? |
| A: The English name of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid is 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid. |
| Q: What is the CAS number of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid? |
| A: CAS number of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid is 98772-02-2. |
| Q: What is the polar surface area (PSA) of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid? |
| A: Polar surface area (PSA) of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid is 104.57000. |
| Q: What English synonyms does 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid have? |
| A: English synonyms of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid: 5-Pyrimidinecarboxylic acid,1,4-dihydro-4-oxo-2-((2-propoxy)phenyl)amino), 1,6-Dihydro-2-(2-propoxyanilino)-6-oxo-5-pyrimidinecarboxylic acid, 1,4-Dihydro-4-oxo-2-((2-propoxyphenyl)amino)-5-pyrimidinecarboxylic acid. |
| Q: What are the upstream materials of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid? |
| A: Related upstream materials(CAS) of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid: 3079-53-6;4469-78-7. |
| Q: What is the LogP of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid? |
| A: LogP of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid is 2.48580. |
| Q: What is the molecular formula of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid? |
| A: Molecular formula of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid is C14H15N3O4. |
| Q: What is the InChIKey of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid? |
| A: InChIKey of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid is SYPFQPZYPNNRJU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid? |
| A: SMILES notation of 6-oxo-2-(2-propoxyanilino)-1H-pyrimidine-5-carboxylic acid is CCCOc1ccccc1Nc1ncc(C(=O)O)c(=O)[nH]1. |