methyl 3-oxo-4-(triphenyl-λ5-phosphanylidene)butanoate structure
|
Common Name | methyl 3-oxo-4-(triphenyl-λ5-phosphanylidene)butanoate | ||
|---|---|---|---|---|
| CAS Number | 98815-59-9 | Molecular Weight | 376.38500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-oxo-4-(triphenyl-λ5-phosphanylidene)butanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H21O3P |
|---|---|
| Molecular Weight | 376.38500 |
| Exact Mass | 376.12300 |
| PSA | 53.18000 |
| LogP | 2.91490 |
| InChIKey | ZXAIAXRMRNCCHC-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~72%
methyl 3-oxo-4-... CAS#:98815-59-9 |
| Literature: Holtz, Edith; Albrecht, Uwe; Langer, Peter Tetrahedron, 2007 , vol. 63, # 16 p. 3293 - 3301 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3-methoxycarbonylacetonylidenetriphenylphosphorane |
| (3-methoxycarbonyl-2-oxopropylidene)triphenylphosphorane |
| methyl 4-(triphenylphosphinylidene)acetoacetate |
| methyl 3-oxo-4-(triphenyl |
| methyl 4-(triphenylphosphoranylidene)-3-oxobutanoate |
| 4-(triphenylphosphanylidene)acetic acid methyl ester |
| methyl 3-oxo-4-(triphenylphosphoranylidene)butanoate |
| METHYL 4-(TRIPHENYLPHOSPHORANYLIDENE)ACETOACETATE |
| methyl 3-oxo-4-(triphenyl-lambda5-phosphanylidene)butanoate |