tert-butyl 2-methyl-3-phenylprop-2-enoate
tert-butyl 2-methyl-3-phenylprop-2-enoate structure
|
Common Name | tert-butyl 2-methyl-3-phenylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 98831-01-7 | Molecular Weight | 218.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 2-methyl-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18O2 |
|---|---|
| Molecular Weight | 218.29200 |
| Exact Mass | 218.13100 |
| PSA | 26.30000 |
| LogP | 3.43160 |
| InChIKey | IVRZNERHUDXGKG-UHFFFAOYSA-N |
| SMILES | CC(=Cc1ccccc1)C(=O)OC(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:5728-95-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl (E)-2-methyl-3-phenylprop-2-enoate |
| (E)-tert-butyl 2-methylcinnamate |
| 2-Propenoic acid,2-methyl-3-phenyl-,1,1-dimethylethyl ester,(2E) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of tert-butyl 2-methyl-3-phenylprop-2-enoate? |
| A: Molecular formula of tert-butyl 2-methyl-3-phenylprop-2-enoate is C14H18O2. |
| Q: What are the downstream products of tert-butyl 2-methyl-3-phenylprop-2-enoate? |
| A: Related downstream products(CAS) of tert-butyl 2-methyl-3-phenylprop-2-enoate: 5728-95-0. |
| Q: What is the molecular weight of tert-butyl 2-methyl-3-phenylprop-2-enoate? |
| A: Molecular weight of tert-butyl 2-methyl-3-phenylprop-2-enoate is 218.29200. |
| Q: What is the CAS number of tert-butyl 2-methyl-3-phenylprop-2-enoate? |
| A: CAS number of tert-butyl 2-methyl-3-phenylprop-2-enoate is 98831-01-7. |
| Q: What is the LogP of tert-butyl 2-methyl-3-phenylprop-2-enoate? |
| A: LogP of tert-butyl 2-methyl-3-phenylprop-2-enoate is 3.43160. |
| Q: What English synonyms does tert-butyl 2-methyl-3-phenylprop-2-enoate have? |
| A: English synonyms of tert-butyl 2-methyl-3-phenylprop-2-enoate: tert-butyl (E)-2-methyl-3-phenylprop-2-enoate, (E)-tert-butyl 2-methylcinnamate, 2-Propenoic acid,2-methyl-3-phenyl-,1,1-dimethylethyl ester,(2E). |
| Q: What is the SMILES notation of tert-butyl 2-methyl-3-phenylprop-2-enoate? |
| A: SMILES notation of tert-butyl 2-methyl-3-phenylprop-2-enoate is CC(=Cc1ccccc1)C(=O)OC(C)(C)C. |
| Q: What is the polar surface area (PSA) of tert-butyl 2-methyl-3-phenylprop-2-enoate? |
| A: Polar surface area (PSA) of tert-butyl 2-methyl-3-phenylprop-2-enoate is 26.30000. |
| Q: What is the InChIKey of tert-butyl 2-methyl-3-phenylprop-2-enoate? |
| A: InChIKey of tert-butyl 2-methyl-3-phenylprop-2-enoate is IVRZNERHUDXGKG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 98831-01-7? |
| A: Chinese name of 98831-01-7 is 98831-01-7. |