[(4E,10Z,12E,14E)-6,24-dihydroxy-16,22-dimethoxy-5,7-dimethyl-18-oxo-19-azabicyclo[18.3.1]tetracosa-1(24),4,10,12,14,20,22-heptaen-8-yl] 2-(cyclohexanecarbonylamino)propanoate structure
|
Common Name | [(4E,10Z,12E,14E)-6,24-dihydroxy-16,22-dimethoxy-5,7-dimethyl-18-oxo-19-azabicyclo[18.3.1]tetracosa-1(24),4,10,12,14,20,22-heptaen-8-yl] 2-(cyclohexanecarbonylamino)propanoate | ||
|---|---|---|---|---|
| CAS Number | 98873-82-6 | Molecular Weight | 652.81700 | |
| Density | 1.18g/cm3 | Boiling Point | 820.5ºC at 760mmHg | |
| Molecular Formula | C37H52N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 450ºC | |
| Name | [(4E,10Z,12E,14E)-6,24-dihydroxy-16,22-dimethoxy-5,7-dimethyl-18-oxo-19-azabicyclo[18.3.1]tetracosa-1(24),4,10,12,14,20,22-heptaen-8-yl] 2-(cyclohexanecarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 820.5ºC at 760mmHg |
| Molecular Formula | C37H52N2O8 |
| Molecular Weight | 652.81700 |
| Flash Point | 450ºC |
| Exact Mass | 652.37200 |
| PSA | 150.40000 |
| LogP | 6.61480 |
| Index of Refraction | 1.575 |
| InChIKey | PEANSLAKPSVOFU-AUESDOCQSA-N |
| SMILES | COc1cc2c(O)c(c1)NC(=O)CC(OC)C=CC=CC=CCC(OC(=O)C(C)NC(=O)C1CCCCC1)C(C)C(O)C(C)=CCC2 |
| 22-O-Methylmycotrienin II |
| D-Alanine,N-(cyclohexylcarbonyl)-,11-ester with 20,23-didehydro-20,23-dideoxo-20-hydroxy-23-methoxyansatrienol A |