2,8-diaminononanedioic acid
Modify Date: 2025-09-18 17:15:52
2,8-diaminononanedioic acid structure
|
Common Name | 2,8-diaminononanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 98951-66-7 | Molecular Weight | 218.25000 | |
| Density | 1.251 g/cm3 | Boiling Point | 442.6ºC at 760 mmHg | |
| Molecular Formula | C9H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.5ºC | |
| Name | 2,8-diaminononanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251 g/cm3 |
|---|---|
| Boiling Point | 442.6ºC at 760 mmHg |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25000 |
| Flash Point | 221.5ºC |
| Exact Mass | 218.12700 |
| PSA | 126.64000 |
| LogP | 1.16130 |
| InChIKey | CZBYDJTWLGVCEV-UHFFFAOYSA-N |
| SMILES | NC(CCCCCC(N)C(=O)O)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
2,8-diaminonona... CAS#:98951-66-7 |
| Literature: Biochemical Journal, , vol. 58, p. 520,521 |
|
~%
2,8-diaminonona... CAS#:98951-66-7 |
| Literature: Biochemical Journal, , vol. 58, p. 520,521 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| nonanedioic acid,2,8-diamino |
| 2,8-Diamino-nonandisaeure |
| 2,8-Diamino-azelainsaeure |
| 2,8-diamino-nonanedioic acid |