Piliformic acid
Modify Date: 2025-09-20 18:01:49
Piliformic acid structure
|
Common Name | Piliformic acid | ||
|---|---|---|---|---|
| CAS Number | 98985-76-3 | Molecular Weight | 214.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Piliformic acidPiliformic acid is a fungal metabolite found in the endophytic fungus Xylariasp sp.(No. 2508) from mangrove trees from the coast of the South China Sea[1]. |
| Name | (+/-)-piliformic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Piliformic acid is a fungal metabolite found in the endophytic fungus Xylariasp sp.(No. 2508) from mangrove trees from the coast of the South China Sea[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H18O4 |
|---|---|
| Molecular Weight | 214.25800 |
| Exact Mass | 214.12100 |
| PSA | 74.60000 |
| LogP | 2.29840 |
| InChIKey | YTUQECDNJQCQAE-VQHVLOKHSA-N |
| SMILES | CCCCCC=C(C(=O)O)C(C)C(=O)O |
|
Name: Antimycobacterial activity was assessed against Mycobacterium tuberculosis H37Ra usin...
Source: ChEMBL
Target: Mycobacterium tuberculosis
External Id: CHEMBL751556
|
|
Name: Cytotoxic activity against human epidermoid carcinoma cells of KB cell lines in mouth
Source: ChEMBL
Target: KB
External Id: CHEMBL699655
|
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: Cytotoxic activity against human breast cancer cells of BC-1 cell lines
Source: ChEMBL
Target: BC1 cell line
External Id: CHEMBL651288
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: UCHL1 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Primary
|
|
Name: OTUD3 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Primary
|
Total 11, Current Page 1 of 2
1
2
| (E)-2-hexylidene-3-methylsuccinic acid |
| (+/-)-(E)-Piliformic acid |
| racemic (E)-2-hexylidene-3-methylsuccinic acid |