4,5,6-trimethyl-2-oxo-1H-pyridine-3-carboxylic acid structure
|
Common Name | 4,5,6-trimethyl-2-oxo-1H-pyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 98996-38-4 | Molecular Weight | 181.18900 | |
| Density | 1.209g/cm3 | Boiling Point | 393.7ºC at 760 mmHg | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
| Name | 4,5,6-trimethyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 393.7ºC at 760 mmHg |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.18900 |
| Flash Point | 191.9ºC |
| Exact Mass | 181.07400 |
| PSA | 70.16000 |
| LogP | 0.99830 |
| Index of Refraction | 1.525 |
| InChIKey | COJZFUMHUMQNEF-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)c(C(=O)O)c(C)c1C |
| HS Code | 2933399090 |
|---|
|
~%
4,5,6-trimethyl... CAS#:98996-38-4 |
| Literature: Dornow; Hahmann Archiv der Pharmazie (Weinheim, Germany), 1957 , vol. 290, p. 20,26 |
|
~%
4,5,6-trimethyl... CAS#:98996-38-4 |
| Literature: Dornow; Hahmann Archiv der Pharmazie (Weinheim, Germany), 1957 , vol. 290, p. 20,26 |
|
~%
4,5,6-trimethyl... CAS#:98996-38-4 |
| Literature: Dornow; Hahmann Archiv der Pharmazie (Weinheim, Germany), 1957 , vol. 290, p. 20,26 |
|
~%
4,5,6-trimethyl... CAS#:98996-38-4 |
| Literature: Dornow; Hahmann Archiv der Pharmazie (Weinheim, Germany), 1957 , vol. 290, p. 20,26 |
|
~%
4,5,6-trimethyl... CAS#:98996-38-4 |
| Literature: Dornow; Hahmann Archiv der Pharmazie (Weinheim, Germany), 1957 , vol. 290, p. 20,26 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-hydroxy-4,5,6-trimethyl-nicotinic acid |
| 4,5,6-Trimethyl-2-oxo-1,2-dihydro-pyridine-3-carboxylic acid |
| 2-Hydroxy-4,5,6-trimethyl-nicotinsaeure |
| 4,5,6-TRIMETHYL-2-OXO-1,2-DIHYDRO-3-PYRIDINECARBOXYLIC ACID |