2-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxypropanoic acid structure
|
Common Name | 2-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxypropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 99007-87-1 | Molecular Weight | 326.30000 | |
| Density | 1.42g/cm3 | Boiling Point | 575.7ºC at 760 mmHg | |
| Molecular Formula | C18H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
| Name | 2-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxypropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 575.7ºC at 760 mmHg |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30000 |
| Flash Point | 214ºC |
| Exact Mass | 326.07900 |
| PSA | 96.97000 |
| LogP | 3.01750 |
| Index of Refraction | 1.647 |
| InChIKey | VVOLYJNOTQWXLG-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1)C(=O)O |
|
Name: Inhibition of hamster liver mitochondrial monoamine oxidase MAO
Source: ChEMBL
Target: Amine oxidase [flavin-containing] B
External Id: CHEMBL731146
|
|
Name: Inhibition of hamster liver aldehyde dehydrogenase ALDH-2
Source: ChEMBL
Target: Aldehyde dehydrogenase, mitochondrial
External Id: CHEMBL641141
|
| 7-(1-Hydroxycarbonylethyl)oxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| 2-((3-(4-Hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl)oxy)propanoic acid |
| Propanoic acid,2-((3-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl)oxy) |