4-Isobutylamino-3-nitroquinoline structure
|
Common Name | 4-Isobutylamino-3-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 99009-85-5 | Molecular Weight | 245.27700 | |
| Density | 1.239g/cm3 | Boiling Point | 398.022ºC at 760 mmHg | |
| Molecular Formula | C13H15N3O2 | Melting Point | 119-121 °C | |
| MSDS | N/A | Flash Point | 194.517ºC | |
| Name | N-(2-methylpropyl)-3-nitroquinolin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 398.022ºC at 760 mmHg |
| Melting Point | 119-121 °C |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.27700 |
| Flash Point | 194.517ºC |
| Exact Mass | 245.11600 |
| PSA | 70.74000 |
| LogP | 3.80710 |
| Index of Refraction | 1.65 |
| InChIKey | CDUWBBGUDMBQDE-UHFFFAOYSA-N |
| SMILES | CC(C)CNc1c([N+](=O)[O-])cnc2ccccc12 |
| HS Code | 2933499090 |
|---|
|
~%
4-Isobutylamino... CAS#:99009-85-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 48, # 10 p. 3481 - 3491 |
|
~%
4-Isobutylamino... CAS#:99009-85-5 |
| Literature: US4689338 A1, ; US 4689338 A |
|
~%
4-Isobutylamino... CAS#:99009-85-5 |
| Literature: US4689338 A1, ; US 4689338 A |
|
~%
4-Isobutylamino... CAS#:99009-85-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 48, # 10 p. 3481 - 3491 |
|
~%
4-Isobutylamino... CAS#:99009-85-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 48, # 10 p. 3481 - 3491 |
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(2-methylpropyl)-3-nitro-quinolin-4-amine |
| QUI030 |
| 4-(2-methylpropylamino)-3-nitroquinoline |
| 3-Nitro-4-(2-methylpropylamino)quinoline |
| 4-isobutyl-3-nitro quinoline |
| 4-Isobutylamino-3-nitroquinoline |
| MFCD07787597 |
| N-(2-methylpropyl)-3-nitro-4-quinolinamine |
| N4-(2-methylpropyl)-3-nitroquinolin-4-amine |
| N-Isobutyl-3-nitroquinolin-4-amine |