2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester
Modify Date: 2026-07-10 16:51:37
![2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester Structure](https://www.chemsrc.com/extcaspic/249/99068-49-2.png)
2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester structure
|
Common Name | 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 99068-49-2 | Molecular Weight | 224.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12N2O2S |
|---|---|
| Molecular Weight | 224.28 |
| InChIKey | PJESMMJVZBWLPU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2sc(C)c(C)n12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester? |
| A: Molecular formula of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester is C10H12N2O2S. |
| Q: What is the molecular weight of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester? |
| A: Molecular weight of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester is 224.28. |
| Q: What is the English name of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester? |
| A: The English name of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester is 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester. |
| Q: What is the SMILES notation of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester? |
| A: SMILES notation of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester is CCOC(=O)c1cnc2sc(C)c(C)n12. |
| Q: What is the CAS number of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester? |
| A: CAS number of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester is 99068-49-2. |
| Q: What is the Chinese name of 99068-49-2? |
| A: Chinese name of 99068-49-2 is 99068-49-2. |
| Q: What is the InChIKey of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester? |
| A: InChIKey of 2,3-Dimethyl-imidazo[2,1-b]thiazole-5-carboxylic acid ethyl ester is PJESMMJVZBWLPU-UHFFFAOYSA-N. |