propan-2-yl N-(2-nitrophenyl)carbamate
Modify Date: 2026-09-15 09:13:23
propan-2-yl N-(2-nitrophenyl)carbamate structure
|
Common Name | propan-2-yl N-(2-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 99068-89-0 | Molecular Weight | 224.21300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | propan-2-yl N-(2-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12N2O4 |
|---|---|
| Molecular Weight | 224.21300 |
| Exact Mass | 224.08000 |
| PSA | 87.64000 |
| LogP | 3.08850 |
| InChIKey | RMVLXSOMIDHPCH-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1ccccc1[N+](=O)[O-] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Carbamic acid,(2-nitrophenyl)-,1-methylethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of propan-2-yl N-(2-nitrophenyl)carbamate? |
| A: LogP of propan-2-yl N-(2-nitrophenyl)carbamate is 3.08850. |
| Q: What is the InChIKey of propan-2-yl N-(2-nitrophenyl)carbamate? |
| A: InChIKey of propan-2-yl N-(2-nitrophenyl)carbamate is RMVLXSOMIDHPCH-UHFFFAOYSA-N. |
| Q: What is the English name of propan-2-yl N-(2-nitrophenyl)carbamate? |
| A: The English name of propan-2-yl N-(2-nitrophenyl)carbamate is propan-2-yl N-(2-nitrophenyl)carbamate. |
| Q: What is the Chinese name of 99068-89-0? |
| A: Chinese name of 99068-89-0 is 99068-89-0. |
| Q: What is the polar surface area (PSA) of propan-2-yl N-(2-nitrophenyl)carbamate? |
| A: Polar surface area (PSA) of propan-2-yl N-(2-nitrophenyl)carbamate is 87.64000. |
| Q: What English synonyms does propan-2-yl N-(2-nitrophenyl)carbamate have? |
| A: English synonyms of propan-2-yl N-(2-nitrophenyl)carbamate: Carbamic acid,(2-nitrophenyl)-,1-methylethyl ester. |
| Q: What is the molecular weight of propan-2-yl N-(2-nitrophenyl)carbamate? |
| A: Molecular weight of propan-2-yl N-(2-nitrophenyl)carbamate is 224.21300. |
| Q: What is the molecular formula of propan-2-yl N-(2-nitrophenyl)carbamate? |
| A: Molecular formula of propan-2-yl N-(2-nitrophenyl)carbamate is C10H12N2O4. |
| Q: What is the SMILES notation of propan-2-yl N-(2-nitrophenyl)carbamate? |
| A: SMILES notation of propan-2-yl N-(2-nitrophenyl)carbamate is CC(C)OC(=O)Nc1ccccc1[N+](=O)[O-]. |
| Q: What is the CAS number of propan-2-yl N-(2-nitrophenyl)carbamate? |
| A: CAS number of propan-2-yl N-(2-nitrophenyl)carbamate is 99068-89-0. |