1-(4-bromophenyl)sulfonyl-3-prop-2-enylthiourea structure
|
Common Name | 1-(4-bromophenyl)sulfonyl-3-prop-2-enylthiourea | ||
|---|---|---|---|---|
| CAS Number | 99070-05-0 | Molecular Weight | 335.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11BrN2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)sulfonyl-3-prop-2-enylthiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11BrN2O2S2 |
|---|---|
| Molecular Weight | 335.24100 |
| Exact Mass | 333.94500 |
| PSA | 105.71000 |
| LogP | 3.67090 |
| InChIKey | FSBKJFUQHVLNIQ-UHFFFAOYSA-N |
| SMILES | C=CCNC(=S)NS(=O)(=O)c1ccc(Br)cc1 |
|
~%
1-(4-bromopheny... CAS#:99070-05-0 |
| Literature: Hans, M.; Dehne, H. Journal fuer Praktische Chemie (Leipzig), 1985 , vol. 327, # 2 p. 235 - 240 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| N-allyl-N'-(4-bromo-benzenesulfonyl)-thiourea |
| 4-bromo-N-(prop-2-en-1-ylcarbamothioyl)benzenesulfonamide |
| Benzenesulfonamide,4-bromo-N-[(2-propenylamino)thioxomethyl] |
| N-Allyl-N'-(4-brom-benzolsulfonyl)-thioharnstoff |