ethyl 4-acetyl-2-amino-5-methylfuran-3-carboxylate
Modify Date: 2025-08-20 17:10:13
ethyl 4-acetyl-2-amino-5-methylfuran-3-carboxylate structure
|
Common Name | ethyl 4-acetyl-2-amino-5-methylfuran-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 99076-38-7 | Molecular Weight | 211.21500 | |
| Density | 1.195g/cm3 | Boiling Point | 367.7ºC at 760 mmHg | |
| Molecular Formula | C10H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.2ºC | |
| Name | ethyl 4-acetyl-2-amino-5-methylfuran-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 367.7ºC at 760 mmHg |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.21500 |
| Flash Point | 176.2ºC |
| Exact Mass | 211.08400 |
| PSA | 82.53000 |
| LogP | 2.13070 |
| Index of Refraction | 1.523 |
| InChIKey | DCRWMYACLRWEAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(N)oc(C)c1C(C)=O |
| HS Code | 2932190090 |
|---|
|
~94%
ethyl 4-acetyl-... CAS#:99076-38-7 |
| Literature: Bakavoli, Mehdi; Feizyzadeh, Babak; Rahimizadeh, Mohammad Tetrahedron Letters, 2006 , vol. 47, # 50 p. 8965 - 8968 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-acetyl-2-amino-5-methyl-furan-3-carboxylic acid ethyl ester |
| 4-Acetyl-2-amino-5-methyl-furan-3-carbonsaeure-aethylester |
| ethyl 4-acetyl-2-amino-5-methyl-3-furoate |