N,2,2-triphenylethenesulfinamide structure
|
Common Name | N,2,2-triphenylethenesulfinamide | ||
|---|---|---|---|---|
| CAS Number | 99081-05-7 | Molecular Weight | 319.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,2,2-triphenylethenesulfinamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H17NOS |
|---|---|
| Molecular Weight | 319.42000 |
| Exact Mass | 319.10300 |
| PSA | 48.31000 |
| LogP | 5.79030 |
| InChIKey | JJSKFTMQUJXKJS-UHFFFAOYSA-N |
| SMILES | O=S(C=C(c1ccccc1)c1ccccc1)Nc1ccccc1 |
|
~%
N,2,2-triphenyl... CAS#:99081-05-7 |
| Literature: Patai; Patchornik Journal of the American Chemical Society, 1952 , vol. 74, p. 4494 |
|
~%
N,2,2-triphenyl... CAS#:99081-05-7 |
| Literature: Katritzky, Alan R.; Lue, Ping; Malhotra, Nageshwar Gazzetta Chimica Italiana, 1991 , vol. 121, # 10 p. 471 - 474 |
|
~%
N,2,2-triphenyl... CAS#:99081-05-7 |
| Literature: Katritzky, Alan R.; Lue, Ping; Malhotra, Nageshwar Gazzetta Chimica Italiana, 1991 , vol. 121, # 10 p. 471 - 474 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,2-Diphenyl-aethensulfinsaeure-anilid |
| 2,2-diphenyl-ethenesulfinic acid anilide |
| Ethenesulfinamide,N,2,2-triphenyl |
| 2,2-diphenylethylenylsulphinanilide |