Propylphenidate
Modify Date: 2025-09-09 19:38:01
Propylphenidate structure
|
Common Name | Propylphenidate | ||
|---|---|---|---|---|
| CAS Number | 99088-50-3 | Molecular Weight | 261.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propylphenidate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23NO2 |
|---|---|
| Molecular Weight | 261.36 |
| InChIKey | PRMWWEANNQSWAR-HUUCEWRRSA-N |
| SMILES | CCCOC(=O)C(c1ccccc1)C1CCCCN1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Propylphenidate? |
| A: InChIKey of Propylphenidate is PRMWWEANNQSWAR-HUUCEWRRSA-N. |
| Q: What is the English name of Propylphenidate? |
| A: The English name of Propylphenidate is Propylphenidate. |
| Q: What is the SMILES notation of Propylphenidate? |
| A: SMILES notation of Propylphenidate is CCCOC(=O)C(c1ccccc1)C1CCCCN1. |
| Q: What is the CAS number of Propylphenidate? |
| A: CAS number of Propylphenidate is 99088-50-3. |
| Q: What is the molecular weight of Propylphenidate? |
| A: Molecular weight of Propylphenidate is 261.36. |
| Q: What is the molecular formula of Propylphenidate? |
| A: Molecular formula of Propylphenidate is C16H23NO2. |
| Q: What is the Chinese name of 99088-50-3? |
| A: Chinese name of 99088-50-3 is 99088-50-3. |