Boc-D-Gln(Xan)-OH
Boc-D-Gln(Xan)-OH structure
|
Common Name | Boc-D-Gln(Xan)-OH | ||
|---|---|---|---|---|
| CAS Number | 99092-88-3 | Molecular Weight | 426.46200 | |
| Density | 1.30 | Boiling Point | N/A | |
| Molecular Formula | C23H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.30 |
|---|---|
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.46200 |
| Exact Mass | 426.17900 |
| PSA | 113.96000 |
| LogP | 4.53780 |
| Appearance of Characters | Powder | White |
| InChIKey | HOIIDGIJEPOSLL-MRXNPFEDSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)NC1c2ccccc2Oc2ccccc21)C(=O)O |
| Storage condition | -15°C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Boc-D-Gln(Xan)-OH |
| AmbotzBAA1180 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: InChIKey of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid is HOIIDGIJEPOSLL-MRXNPFEDSA-N. |
| Q: What are the storage conditions for (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: Storage conditions for (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid: -15°C. |
| Q: What is the LogP of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: LogP of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid is 4.53780. |
| Q: What English synonyms does (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid have? |
| A: English synonyms of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid: Boc-D-Gln(Xan)-OH, AmbotzBAA1180. |
| Q: What is the SMILES notation of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: SMILES notation of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid is CC(C)(C)OC(=O)NC(CCC(=O)NC1c2ccccc2Oc2ccccc21)C(=O)O. |
| Q: What is the polar surface area (PSA) of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: Polar surface area (PSA) of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid is 113.96000. |
| Q: What is the molecular weight of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: Molecular weight of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid is 426.46200. |
| Q: What is the physical appearance of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid appears as Powder | White. |
| Q: What is the molecular formula of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: Molecular formula of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid is C23H26N2O6. |
| Q: What is the CAS number of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid? |
| A: CAS number of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid is 99092-88-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |