Prosurugatoxin
Modify Date: 2025-09-09 18:02:14
Prosurugatoxin structure
|
Common Name | Prosurugatoxin | ||
|---|---|---|---|---|
| CAS Number | 99102-40-6 | Molecular Weight | 652.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H26BrN5O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Prosurugatoxin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H26BrN5O11 |
|---|---|
| Molecular Weight | 652.4 |
| InChIKey | AFDHDUMCMVFEIH-RXSVICFYSA-N |
| SMILES | CC1(O)C2=Nc3c([nH]c(=O)[nH]c3=O)NCC2C(C(=O)OC2C(O)C(O)C(O)C(O)C2O)C12C(=O)Nc1cc(Br)ccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Prosurugatoxin? |
| A: SMILES notation of Prosurugatoxin is CC1(O)C2=Nc3c([nH]c(=O)[nH]c3=O)NCC2C(C(=O)OC2C(O)C(O)C(O)C(O)C2O)C12C(=O)Nc1cc(Br)ccc12. |
| Q: What is the InChIKey of Prosurugatoxin? |
| A: InChIKey of Prosurugatoxin is AFDHDUMCMVFEIH-RXSVICFYSA-N. |
| Q: What is the molecular formula of Prosurugatoxin? |
| A: Molecular formula of Prosurugatoxin is C25H26BrN5O11. |
| Q: What is the Chinese name of 99102-40-6? |
| A: Chinese name of 99102-40-6 is 99102-40-6. |
| Q: What is the English name of Prosurugatoxin? |
| A: The English name of Prosurugatoxin is Prosurugatoxin. |
| Q: What is the CAS number of Prosurugatoxin? |
| A: CAS number of Prosurugatoxin is 99102-40-6. |
| Q: What is the molecular weight of Prosurugatoxin? |
| A: Molecular weight of Prosurugatoxin is 652.4. |