(Z)-3,9-diethyltridec-7-en-6-one structure
|
Common Name | (Z)-3,9-diethyltridec-7-en-6-one | ||
|---|---|---|---|---|
| CAS Number | 99148-56-8 | Molecular Weight | 252.43500 | |
| Density | 0.839g/cm3 | Boiling Point | 337.6ºC at 760 mmHg | |
| Molecular Formula | C17H32O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.7ºC | |
| Name | (Z)-3,9-diethyltridec-7-en-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.839g/cm3 |
|---|---|
| Boiling Point | 337.6ºC at 760 mmHg |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.43500 |
| Flash Point | 170.7ºC |
| Exact Mass | 252.24500 |
| PSA | 17.07000 |
| LogP | 5.54450 |
| Index of Refraction | 1.45 |
| InChIKey | JGDGJCODFVJCLV-UHFFFAOYSA-N |
| SMILES | CCCCC(C=CC(=O)CCC(CC)CC)CC |
|
~%
(Z)-3,9-diethyl... CAS#:99148-56-8 |
| Literature: Union Carbide and Carbon Corp. Patent: US2088017 , 1934 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,9-Diaethyl-tridec-7-en-6-on |
| 7-Tridecen-6-one,3,9-diethyl |
| 3,9-diethyl-tridec-7-en-6-one |