Erythromycin A N-oxide structure
|
Common Name | Erythromycin A N-oxide | ||
|---|---|---|---|---|
| CAS Number | 992-65-4 | Molecular Weight | 749.92600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H67NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Erythromycin A N-oxideErythromycin A N-oxide is a potential impurity found in commercial preparations of erythromycin. |
| Name | (2S,3R,4S,6R)-2-[[(3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-14-ethyl-7,12,13-trihydroxy-4-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,13-hexamethyl-2,10-dioxo-oxacyclotetradec-6-yl]oxy]-3-hydroxy-N,N,6-trimethyloxan-4-amine oxide |
|---|
| Molecular Formula | C37H67NO14 |
|---|---|
| Molecular Weight | 749.92600 |
| Exact Mass | 749.45600 |
| PSA | 220.10000 |
| LogP | 1.81910 |
| InChIKey | LUIPOVCSQJTWHA-LUXFRRLCSA-N |
| SMILES | CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(OC2OC(C)CC([N+](C)(C)[O-])C2O)C(C)(O)CC(C)C(=O)C(C)C(O)C1(C)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |