7-[bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-phenyl-methoxy]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-heptane structure
|
Common Name | 7-[bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-phenyl-methoxy]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-heptane | ||
|---|---|---|---|---|
| CAS Number | 992-81-4 | Molecular Weight | 1082.35000 | |
| Density | 1.614g/cm3 | Boiling Point | 483.7ºC at 760 mmHg | |
| Molecular Formula | C28H14F36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.1ºC | |
| Name | tris(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)methylbenzene |
|---|
| Density | 1.614g/cm3 |
|---|---|
| Boiling Point | 483.7ºC at 760 mmHg |
| Molecular Formula | C28H14F36O3 |
| Molecular Weight | 1082.35000 |
| Flash Point | 256.1ºC |
| Exact Mass | 1082.04000 |
| PSA | 27.69000 |
| LogP | 13.17150 |
| Index of Refraction | 1.334 |
| InChIKey | UDKKZCTXVLNCDM-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1ccccc1 |
|
~%
7-[bis(2,2,3,3,... CAS#:992-81-4 |
| Literature: Hill,M.E. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 411 - 415 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |