3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid structure
|
Common Name | 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 99208-26-1 | Molecular Weight | 278.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14N2O5 |
|---|---|
| Molecular Weight | 278.26100 |
| Exact Mass | 278.09000 |
| PSA | 101.51000 |
| LogP | 0.95750 |
| InChIKey | IPCXQGZLHLEGKG-UHFFFAOYSA-N |
| SMILES | COc1cc2nc(CCC(=O)O)c(=O)[nH]c2cc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~79%
3-(6,7-dimethox... CAS#:99208-26-1 |
| Literature: Hara, Shuuji; Yamaguchi, Masatoshi; Nakamura, Masaru; Ohkura, Yosuke Chemical & Pharmaceutical Bulletin, 1985 , vol. 33, # 8 p. 3493 - 3498 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,4-Dihydro-6,7-dimethoxy-3-oxo-2-quinoxalinepropanoic Acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: SMILES notation of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid is COc1cc2nc(CCC(=O)O)c(=O)[nH]c2cc1OC. |
| Q: What English synonyms does 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid have? |
| A: English synonyms of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid: 3,4-Dihydro-6,7-dimethoxy-3-oxo-2-quinoxalinepropanoic Acid. |
| Q: What is the English name of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: The English name of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid is 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid. |
| Q: What is the molecular formula of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: Molecular formula of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid is C13H14N2O5. |
| Q: What is the molecular weight of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: Molecular weight of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid is 278.26100. |
| Q: What is the CAS number of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: CAS number of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid is 99208-26-1. |
| Q: What is the LogP of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: LogP of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid is 0.95750. |
| Q: What is the polar surface area (PSA) of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: Polar surface area (PSA) of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid is 101.51000. |
| Q: What is the InChIKey of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: InChIKey of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid is IPCXQGZLHLEGKG-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid? |
| A: Related upstream materials(CAS) of 3-(6,7-dimethoxy-3-oxo-4H-quinoxalin-2-yl)propanoic acid: 328-50-7;88580-71-6. |