3-(Fluoromethyl)-3-buten-1-yl trihydrogen diphosphate structure
|
Common Name | 3-(Fluoromethyl)-3-buten-1-yl trihydrogen diphosphate | ||
|---|---|---|---|---|
| CAS Number | 99282-16-3 | Molecular Weight | 264.08300 | |
| Density | 1.6g/cm3 | Boiling Point | 455.2ºC at 760mmHg | |
| Molecular Formula | C5H11FO7P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.1ºC | |
| Name | 3-(Fluoromethyl)-3-buten-1-yl trihydrogen diphosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 455.2ºC at 760mmHg |
| Molecular Formula | C5H11FO7P2 |
| Molecular Weight | 264.08300 |
| Flash Point | 229.1ºC |
| Exact Mass | 263.99600 |
| PSA | 132.91000 |
| LogP | 1.12850 |
| Index of Refraction | 1.479 |
| InChIKey | RHZKOFJYQGKKAO-UHFFFAOYSA-N |
| SMILES | C=C(CF)CCOP(=O)(O)OP(=O)(O)O |
| HS Code | 2905590090 |
|---|
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| isoquinoline,3-fluoro |
| 3-Fluoro-isoquinoline |
| m-fluoromandelic acid |
| 3-fluoro-mandelic acid |
| 3-Fluor-mandelsaeure |
| 3-Fluor-isochinolin |
| 3-fluoromethyl-3-buten-1-yl diphosphate |
| D-3-fluoro-mandelic acid |