5-Methyltryptophan structure
|
Common Name | 5-Methyltryptophan | ||
|---|---|---|---|---|
| CAS Number | 99295-79-1 | Molecular Weight | 218.252 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 455.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.1±28.7 °C | |
| Name | (2R)-2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.1±45.0 °C at 760 mmHg |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.252 |
| Flash Point | 229.1±28.7 °C |
| Exact Mass | 218.105530 |
| PSA | 79.11000 |
| LogP | 1.50 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | HUNCSWANZMJLPM-SNVBAGLBSA-N |
| SMILES | Cc1ccc2[nH]cc(CC(N)C(=O)O)c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Methyltryptophan |
| Tryptophan, 5-methyl- |
| 5-methyl-D-tryptophan |
| D-Tryptophan,5-methyl |